ethyl N,N-dimethyloxamate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

ethyl dimethyloxamate; ethyl N,N-dimethyloxamate
Links:📏 NIST
CAS RN:[16703-52-9]
Formula:C6H11NO3; 145.16 g/mol
InChiKey:HMALWDVRMHVUAW-UHFFFAOYSA-N
SMILES:CCOC(=O)C(=O)N(C)C
Molecular structure of ethyl N,N-dimethyloxamate
Density:1.074 g/mL
Molar volume:135.2 mL/mol
Refractive index:1.441
Molecular refractive power:35.74 mL/mol

Isomers

2-acetamidobutanoic acid
Molecular structure of 2-acetamidobutanoic acid
4-acetamidobutanoic acid
Molecular structure of 4-acetamidobutanoic acid
adipamic acid
Molecular structure of adipamic acid
6-aminocyclohex-4-ene-1,2,3-triol
Molecular structure of 6-aminocyclohex-4-ene-1,2,3-triol
butyl oxamate
Molecular structure of butyl oxamate
4-dimethylamino-4-oxobutanoic acid
Molecular structure of 4-dimethylamino-4-oxobutanoic acid
ethyl 2-acetamidoacetate
Molecular structure of ethyl 2-acetamidoacetate
ethyl N,N-dimethyloxamate
Molecular structure of ethyl N,N-dimethyloxamate
formylvaline
Molecular structure of formylvaline
(S)-methyl 2-acetamidopropanoate
Molecular structure of (S)-methyl 2-acetamidopropanoate
methyl 5-amino-4-oxopentanoate
Molecular structure of methyl 5-amino-4-oxopentanoate
  ::